C13H25NO3 — CID 11311091
(2R,3R,4R)-2-methyl-3,4-bis[(2-methylpropan-2-yl)oxy]-1-oxido-3,4-dihydro-2H-pyrrol-1-ium (PubChem CID 11311091) has the molecular formula C13H25NO3 and a molecular weight of 243.35 g/mol. Its IUPAC name is (2R,3R,4R)-2-methyl-3,4-bis[(2-methylpropan-2-yl)oxy]-1-oxido-3,4-dihydro-2H-pyrrol-1-ium.
| Compound Name | (2R,3R,4R)-2-methyl-3,4-bis[(2-methylpropan-2-yl)oxy]-1-oxido-3,4-dihydro-2H-pyrrol-1-ium |
|---|---|
| PubChem CID | 11311091 |
| Molecular Formula | C13H25NO3 |
| Molecular Weight | 243.35 g/mol |
| Exact Mass | 243.18 |
| IUPAC Name | (2R,3R,4R)-2-methyl-3,4-bis[(2-methylpropan-2-yl)oxy]-1-oxido-3,4-dihydro-2H-pyrrol-1-ium |
| SMILES | C[C@@H]1[C@@H](OC(C)(C)C)[C@H](OC(C)(C)C)C=[N+]1[O-] |
| InChI | InChI=1S/C13H25NO3/c1-9-11(17-13(5,6)7)10(8-14(9)15)16-12(2,3)4/h8-11H,1-7H3/t9-,10-,11-/m1/s1 |
| InChIKey | XVQNNHQRPRJQGI-GMTAPVOTSA-N |
| XLogP | 2.34 |
| TPSA | 44.53 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 2 |
| Heavy Atoms | 17 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 243.35 |
| LogP ≤ 5 | 2.34 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 3 |
| Structural Alerts | {'alert_name': 'quaternary_nitrogen_1', 'substructure': 'N/A'} |
|---|