C18H18Cl2FN3O2 — CID 113113341
N-(3-chloro-4-fluorophenyl)-4-(5-chloro-2-methoxyphenyl)piperazine-1-carboxamide (PubChem CID 113113341) has the molecular formula C18H18Cl2FN3O2 and a molecular weight of 398.27 g/mol. Its IUPAC name is N-(3-chloro-4-fluorophenyl)-4-(5-chloro-2-methoxyphenyl)piperazine-1-carboxamide.
| Compound Name | N-(3-chloro-4-fluorophenyl)-4-(5-chloro-2-methoxyphenyl)piperazine-1-carboxamide |
|---|---|
| PubChem CID | 113113341 |
| Molecular Formula | C18H18Cl2FN3O2 |
| Molecular Weight | 398.27 g/mol |
| Exact Mass | 397.08 |
| IUPAC Name | N-(3-chloro-4-fluorophenyl)-4-(5-chloro-2-methoxyphenyl)piperazine-1-carboxamide |
| SMILES | COc1ccc(Cl)cc1N1CCN(C(=O)Nc2ccc(F)c(Cl)c2)CC1 |
| InChI | InChI=1S/C18H18Cl2FN3O2/c1-26-17-5-2-12(19)10-16(17)23-6-8-24(9-7-23)18(25)22-13-3-4-15(21)14(20)11-13/h2-5,10-11H,6-9H2,1H3,(H,22,25) |
| InChIKey | KQGJIBVKIIVUHI-UHFFFAOYSA-N |
| XLogP | 4.50 |
| TPSA | 44.81 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 3 |
| Heavy Atoms | 26 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 398.27 |
| LogP ≤ 5 | 4.50 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 3 |