C10H14N2O6 — CID 11311447
methyl (5R,6R,7S,8R)-6,7,8-trihydroxy-5-(hydroxymethyl)-5,6,7,8-tetrahydroimidazo[1,2-a]pyridine-2-carboxylate (PubChem CID 11311447) has the molecular formula C10H14N2O6 and a molecular weight of 258.23 g/mol. Its IUPAC name is methyl (5R,6R,7S,8R)-6,7,8-trihydroxy-5-(hydroxymethyl)-5,6,7,8-tetrahydroimidazo[1,2-a]pyridine-2-carboxylate.
| Compound Name | methyl (5R,6R,7S,8R)-6,7,8-trihydroxy-5-(hydroxymethyl)-5,6,7,8-tetrahydroimidazo[1,2-a]pyridine-2-carboxylate |
|---|---|
| PubChem CID | 11311447 |
| Molecular Formula | C10H14N2O6 |
| Molecular Weight | 258.23 g/mol |
| Exact Mass | 258.09 |
| IUPAC Name | methyl (5R,6R,7S,8R)-6,7,8-trihydroxy-5-(hydroxymethyl)-5,6,7,8-tetrahydroimidazo[1,2-a]pyridine-2-carboxylate |
| SMILES | COC(=O)c1cn2c(n1)[C@@H](O)[C@@H](O)[C@H](O)[C@H]2CO |
| InChI | InChI=1S/C10H14N2O6/c1-18-10(17)4-2-12-5(3-13)6(14)7(15)8(16)9(12)11-4/h2,5-8,13-16H,3H2,1H3/t5-,6-,7+,8+/m1/s1 |
| InChIKey | LJYCTHOGEIUQFM-NGJRWZKOSA-N |
| XLogP | -2.03 |
| TPSA | 125.04 Ų |
| H-Bond Donors | 4 |
| H-Bond Acceptors | 8 |
| Rotatable Bonds | 2 |
| Heavy Atoms | 18 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 258.23 |
| LogP ≤ 5 | -2.03 |
| H-Bond Donors ≤ 5 | 4 |
| H-Bond Acceptors ≤ 10 | 8 |