C17H23ClN2O2 — CID 113116338
3-[acetyl(cyclopentyl)amino]-N-[(2-chlorophenyl)methyl]propanamide (PubChem CID 113116338) has the molecular formula C17H23ClN2O2 and a molecular weight of 322.84 g/mol. Its IUPAC name is 3-[acetyl(cyclopentyl)amino]-N-[(2-chlorophenyl)methyl]propanamide.
| Compound Name | 3-[acetyl(cyclopentyl)amino]-N-[(2-chlorophenyl)methyl]propanamide |
|---|---|
| PubChem CID | 113116338 |
| Molecular Formula | C17H23ClN2O2 |
| Molecular Weight | 322.84 g/mol |
| Exact Mass | 322.14 |
| IUPAC Name | 3-[acetyl(cyclopentyl)amino]-N-[(2-chlorophenyl)methyl]propanamide |
| SMILES | CC(=O)N(CCC(=O)NCc1ccccc1Cl)C1CCCC1 |
| InChI | InChI=1S/C17H23ClN2O2/c1-13(21)20(15-7-3-4-8-15)11-10-17(22)19-12-14-6-2-5-9-16(14)18/h2,5-6,9,15H,3-4,7-8,10-12H2,1H3,(H,19,22) |
| InChIKey | DNZHMYHRLSPJHE-UHFFFAOYSA-N |
| XLogP | 3.14 |
| TPSA | 49.41 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 2 |
| Rotatable Bonds | 6 |
| Heavy Atoms | 22 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 322.84 |
| LogP ≤ 5 | 3.14 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 2 |