C15H22O4 — CID 11311643
[(2S,3R,4S)-3-ethenyl-4-(3-oxoprop-1-en-2-yl)oxan-2-yl] 2,2-dimethylpropanoate (PubChem CID 11311643) has the molecular formula C15H22O4 and a molecular weight of 266.34 g/mol. Its IUPAC name is [(2S,3R,4S)-3-ethenyl-4-(3-oxoprop-1-en-2-yl)oxan-2-yl] 2,2-dimethylpropanoate.
| Compound Name | [(2S,3R,4S)-3-ethenyl-4-(3-oxoprop-1-en-2-yl)oxan-2-yl] 2,2-dimethylpropanoate |
|---|---|
| PubChem CID | 11311643 |
| Molecular Formula | C15H22O4 |
| Molecular Weight | 266.34 g/mol |
| Exact Mass | 266.15 |
| IUPAC Name | [(2S,3R,4S)-3-ethenyl-4-(3-oxoprop-1-en-2-yl)oxan-2-yl] 2,2-dimethylpropanoate |
| SMILES | C=C[C@H]1[C@H](OC(=O)C(C)(C)C)OCC[C@@H]1C(=C)C=O |
| InChI | InChI=1S/C15H22O4/c1-6-11-12(10(2)9-16)7-8-18-13(11)19-14(17)15(3,4)5/h6,9,11-13H,1-2,7-8H2,3-5H3/t11-,12-,13+/m1/s1 |
| InChIKey | RSOMCRVTBGMFPA-UPJWGTAASA-N |
| XLogP | 2.50 |
| TPSA | 52.60 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 4 |
| Heavy Atoms | 19 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 266.34 |
| LogP ≤ 5 | 2.50 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 4 |
| Structural Alerts | {'alert_name': 'aldehyde', 'substructure': 'N/A'}, {'alert_name': 'isolated_alkene', 'substructure': 'N/A'}, {'alert_name': 'Michael_acceptor_1', 'substructure': 'N/A'} |
|---|