C14H22N2O3 — CID 11311649
1-tert-butyl-4,4-dimethyl-2,5-dioxo-N-prop-2-enylpyrrolidine-3-carboxamide (PubChem CID 11311649) has the molecular formula C14H22N2O3 and a molecular weight of 266.34 g/mol. Its IUPAC name is 1-tert-butyl-4,4-dimethyl-2,5-dioxo-N-prop-2-enylpyrrolidine-3-carboxamide.
| Compound Name | 1-tert-butyl-4,4-dimethyl-2,5-dioxo-N-prop-2-enylpyrrolidine-3-carboxamide |
|---|---|
| PubChem CID | 11311649 |
| Molecular Formula | C14H22N2O3 |
| Molecular Weight | 266.34 g/mol |
| Exact Mass | 266.16 |
| IUPAC Name | 1-tert-butyl-4,4-dimethyl-2,5-dioxo-N-prop-2-enylpyrrolidine-3-carboxamide |
| SMILES | C=CCNC(=O)C1C(=O)N(C(C)(C)C)C(=O)C1(C)C |
| InChI | InChI=1S/C14H22N2O3/c1-7-8-15-10(17)9-11(18)16(13(2,3)4)12(19)14(9,5)6/h7,9H,1,8H2,2-6H3,(H,15,17) |
| InChIKey | PPBNKMOYCJAVIU-UHFFFAOYSA-N |
| XLogP | 1.10 |
| TPSA | 66.48 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 3 |
| Heavy Atoms | 19 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 266.34 |
| LogP ≤ 5 | 1.10 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 3 |
| Structural Alerts | {'alert_name': 'beta-keto/anhydride', 'substructure': 'N/A'}, {'alert_name': 'isolated_alkene', 'substructure': 'N/A'}, {'alert_name': 'phthalimide', 'substructure': 'N/A'} |
|---|