C14H26N2O3 — CID 113117319
3-[acetyl(oxolan-2-ylmethyl)amino]-N,N-diethylpropanamide (PubChem CID 113117319) has the molecular formula C14H26N2O3 and a molecular weight of 270.37 g/mol. Its IUPAC name is 3-[acetyl(oxolan-2-ylmethyl)amino]-N,N-diethylpropanamide.
| Compound Name | 3-[acetyl(oxolan-2-ylmethyl)amino]-N,N-diethylpropanamide |
|---|---|
| PubChem CID | 113117319 |
| Molecular Formula | C14H26N2O3 |
| Molecular Weight | 270.37 g/mol |
| Exact Mass | 270.19 |
| IUPAC Name | 3-[acetyl(oxolan-2-ylmethyl)amino]-N,N-diethylpropanamide |
| SMILES | CCN(CC)C(=O)CCN(CC1CCCO1)C(C)=O |
| InChI | InChI=1S/C14H26N2O3/c1-4-15(5-2)14(18)8-9-16(12(3)17)11-13-7-6-10-19-13/h13H,4-11H2,1-3H3 |
| InChIKey | ITGNWAMBDMHSPZ-UHFFFAOYSA-N |
| XLogP | 1.27 |
| TPSA | 49.85 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 7 |
| Heavy Atoms | 19 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 270.37 |
| LogP ≤ 5 | 1.27 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 3 |