C18H25NO — CID 11311787
7-[bis(prop-2-enyl)amino]-8,8-dimethyl-6,7-dihydro-5H-naphthalen-2-ol (PubChem CID 11311787) has the molecular formula C18H25NO and a molecular weight of 271.40 g/mol. Its IUPAC name is 7-[bis(prop-2-enyl)amino]-8,8-dimethyl-6,7-dihydro-5H-naphthalen-2-ol.
| Compound Name | 7-[bis(prop-2-enyl)amino]-8,8-dimethyl-6,7-dihydro-5H-naphthalen-2-ol |
|---|---|
| PubChem CID | 11311787 |
| Molecular Formula | C18H25NO |
| Molecular Weight | 271.40 g/mol |
| Exact Mass | 271.19 |
| IUPAC Name | 7-[bis(prop-2-enyl)amino]-8,8-dimethyl-6,7-dihydro-5H-naphthalen-2-ol |
| SMILES | C=CCN(CC=C)C1CCc2ccc(O)cc2C1(C)C |
| InChI | InChI=1S/C18H25NO/c1-5-11-19(12-6-2)17-10-8-14-7-9-15(20)13-16(14)18(17,3)4/h5-7,9,13,17,20H,1-2,8,10-12H2,3-4H3 |
| InChIKey | SNFJJCDHDZXMFR-UHFFFAOYSA-N |
| XLogP | 3.66 |
| TPSA | 23.47 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 2 |
| Rotatable Bonds | 5 |
| Heavy Atoms | 20 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 271.40 |
| LogP ≤ 5 | 3.66 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 2 |
| Structural Alerts | {'alert_name': 'isolated_alkene', 'substructure': 'N/A'} |
|---|