About N-hepta-1,6-dien-4-yl-N-oct-2-ynylprop-2-enamide
N-hepta-1,6-dien-4-yl-N-oct-2-ynylprop-2-enamide (PubChem CID 11311853) has the molecular formula C18H27NO
and a molecular weight of 273.42 g/mol. Its IUPAC name is N-hepta-1,6-dien-4-yl-N-oct-2-ynylprop-2-enamide.
Molecular Properties
| Compound Name | N-hepta-1,6-dien-4-yl-N-oct-2-ynylprop-2-enamide |
| PubChem CID | 11311853 |
| Molecular Formula | C18H27NO |
| Molecular Weight | 273.42 g/mol |
| Exact Mass | 273.21 |
| IUPAC Name | N-hepta-1,6-dien-4-yl-N-oct-2-ynylprop-2-enamide |
| SMILES | C=CCC(CC=C)N(CC#CCCCCC)C(=O)C=C |
| InChI | InChI=1S/C18H27NO/c1-5-9-10-11-12-13-16-19(18(20)8-4)17(14-6-2)15-7-3/h6-8,17H,2-5,9-11,14-16H2,1H3 |
| InChIKey | CBIIYMDIISQAMB-UHFFFAOYSA-N |
| XLogP | 4.11 |
| TPSA | 20.31 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 1 |
| Rotatable Bonds | 10 |
| Heavy Atoms | 20 |
| Complexity | — |
Lipinski Rule of Five
Passes Rule of Five
| Rule | Value |
| MW ≤ 500 | 273.42 |
| LogP ≤ 5 | 4.11 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 1 |
Computed Properties (RDKit)
| Structural Alerts | {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'}, {'alert_name': 'isolated_alkene', 'substructure': 'N/A'}, {'alert_name': 'Michael_acceptor_1', 'substructure': 'N/A'}, {'alert_name': 'triple_bond', 'substructure': 'N/A'} |
|---|
Analyze N-hepta-1,6-dien-4-yl-N-oct-2-ynylprop-2-enamide with MolForge
Explore ADMET properties, 3D molecular structure, drug-likeness score, and discover similar compounds using our AI-powered platform.
Launch Full Analysis
Frequently Asked Questions
What is the IUPAC name of N-hepta-1,6-dien-4-yl-N-oct-2-ynylprop-2-enamide?
The IUPAC name of N-hepta-1,6-dien-4-yl-N-oct-2-ynylprop-2-enamide (CID 11311853) is N-hepta-1,6-dien-4-yl-N-oct-2-ynylprop-2-enamide.
What is the SMILES notation for N-hepta-1,6-dien-4-yl-N-oct-2-ynylprop-2-enamide?
The canonical SMILES for N-hepta-1,6-dien-4-yl-N-oct-2-ynylprop-2-enamide is C=CCC(CC=C)N(CC#CCCCCC)C(=O)C=C.
What is the InChIKey of N-hepta-1,6-dien-4-yl-N-oct-2-ynylprop-2-enamide?
The InChIKey is CBIIYMDIISQAMB-UHFFFAOYSA-N. The full InChI is InChI=1S/C18H27NO/c1-5-9-10-11-12-13-16-19(18(20)8-4)17(14-6-2)15-7-3/h6-8,17H,2-5,9-11,14-16H2,1H3.
What are the key properties of N-hepta-1,6-dien-4-yl-N-oct-2-ynylprop-2-enamide?
N-hepta-1,6-dien-4-yl-N-oct-2-ynylprop-2-enamide has a molecular weight of 273.42 g/mol, XLogP of 4.11, 10 rotatable bonds, 0 hydrogen bond donors, and 1 hydrogen bond acceptors.
Where does this data come from?
All data for N-hepta-1,6-dien-4-yl-N-oct-2-ynylprop-2-enamide is sourced from PubChem (CID 11311853), the world's largest open chemistry database maintained by the National Library of Medicine (NIH).