About 1,1,3-tributoxybutane
1,1,3-tributoxybutane (PubChem CID 11311877) has the molecular formula C16H34O3
and a molecular weight of 274.44 g/mol. Its IUPAC name is 1,1,3-tributoxybutane.
Molecular Properties
| Compound Name | 1,1,3-tributoxybutane |
| PubChem CID | 11311877 |
| Molecular Formula | C16H34O3 |
| Molecular Weight | 274.44 g/mol |
| Exact Mass | 274.25 |
| IUPAC Name | 1,1,3-tributoxybutane |
| SMILES | CCCCOC(C)CC(OCCCC)OCCCC |
| InChI | InChI=1S/C16H34O3/c1-5-8-11-17-15(4)14-16(18-12-9-6-2)19-13-10-7-3/h15-16H,5-14H2,1-4H3 |
| InChIKey | BVJWWEDLLIXXBR-UHFFFAOYSA-N |
| XLogP | 4.54 |
| TPSA | 27.69 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 14 |
| Heavy Atoms | 19 |
| Complexity | — |
Lipinski Rule of Five
Passes Rule of Five
| Rule | Value |
| MW ≤ 500 | 274.44 |
| LogP ≤ 5 | 4.54 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 3 |
Computed Properties (RDKit)
| Structural Alerts | {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'}, {'alert_name': 'het-C-het_not_in_ring', 'substructure': 'N/A'} |
|---|
Analyze 1,1,3-tributoxybutane with MolForge
Explore ADMET properties, 3D molecular structure, drug-likeness score, and discover similar compounds using our AI-powered platform.
Launch Full Analysis
Frequently Asked Questions
What is the IUPAC name of 1,1,3-tributoxybutane?
The IUPAC name of 1,1,3-tributoxybutane (CID 11311877) is 1,1,3-tributoxybutane.
What is the SMILES notation for 1,1,3-tributoxybutane?
The canonical SMILES for 1,1,3-tributoxybutane is CCCCOC(C)CC(OCCCC)OCCCC.
What is the InChIKey of 1,1,3-tributoxybutane?
The InChIKey is BVJWWEDLLIXXBR-UHFFFAOYSA-N. The full InChI is InChI=1S/C16H34O3/c1-5-8-11-17-15(4)14-16(18-12-9-6-2)19-13-10-7-3/h15-16H,5-14H2,1-4H3.
What are the key properties of 1,1,3-tributoxybutane?
1,1,3-tributoxybutane has a molecular weight of 274.44 g/mol, XLogP of 4.54, 14 rotatable bonds, 0 hydrogen bond donors, and 3 hydrogen bond acceptors.
Where does this data come from?
All data for 1,1,3-tributoxybutane is sourced from PubChem (CID 11311877), the world's largest open chemistry database maintained by the National Library of Medicine (NIH).