C16H23FN2O2 — CID 113119070
3-[acetyl-[(2-fluorophenyl)methyl]amino]-N-butan-2-ylpropanamide (PubChem CID 113119070) has the molecular formula C16H23FN2O2 and a molecular weight of 294.37 g/mol. Its IUPAC name is 3-[acetyl-[(2-fluorophenyl)methyl]amino]-N-butan-2-ylpropanamide.
| Compound Name | 3-[acetyl-[(2-fluorophenyl)methyl]amino]-N-butan-2-ylpropanamide |
|---|---|
| PubChem CID | 113119070 |
| Molecular Formula | C16H23FN2O2 |
| Molecular Weight | 294.37 g/mol |
| Exact Mass | 294.17 |
| IUPAC Name | 3-[acetyl-[(2-fluorophenyl)methyl]amino]-N-butan-2-ylpropanamide |
| SMILES | CCC(C)NC(=O)CCN(Cc1ccccc1F)C(C)=O |
| InChI | InChI=1S/C16H23FN2O2/c1-4-12(2)18-16(21)9-10-19(13(3)20)11-14-7-5-6-8-15(14)17/h5-8,12H,4,9-11H2,1-3H3,(H,18,21) |
| InChIKey | MQWCKGWPZDNSON-UHFFFAOYSA-N |
| XLogP | 2.48 |
| TPSA | 49.41 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 2 |
| Rotatable Bonds | 7 |
| Heavy Atoms | 21 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 294.37 |
| LogP ≤ 5 | 2.48 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 2 |