C19H21FN2O3 — CID 113119801
3-[acetyl-[(2-methoxyphenyl)methyl]amino]-N-(2-fluorophenyl)propanamide (PubChem CID 113119801) has the molecular formula C19H21FN2O3 and a molecular weight of 344.39 g/mol. Its IUPAC name is 3-[acetyl-[(2-methoxyphenyl)methyl]amino]-N-(2-fluorophenyl)propanamide.
| Compound Name | 3-[acetyl-[(2-methoxyphenyl)methyl]amino]-N-(2-fluorophenyl)propanamide |
|---|---|
| PubChem CID | 113119801 |
| Molecular Formula | C19H21FN2O3 |
| Molecular Weight | 344.39 g/mol |
| Exact Mass | 344.15 |
| IUPAC Name | 3-[acetyl-[(2-methoxyphenyl)methyl]amino]-N-(2-fluorophenyl)propanamide |
| SMILES | COc1ccccc1CN(CCC(=O)Nc1ccccc1F)C(C)=O |
| InChI | InChI=1S/C19H21FN2O3/c1-14(23)22(13-15-7-3-6-10-18(15)25-2)12-11-19(24)21-17-9-5-4-8-16(17)20/h3-10H,11-13H2,1-2H3,(H,21,24) |
| InChIKey | HMYDTFMCBDMWBT-UHFFFAOYSA-N |
| XLogP | 3.21 |
| TPSA | 58.64 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 7 |
| Heavy Atoms | 25 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 344.39 |
| LogP ≤ 5 | 3.21 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 3 |