C10H15BrO4 — CID 11311995
methyl (E)-3-[(4R,5S)-5-(bromomethyl)-2,2-dimethyl-1,3-dioxolan-4-yl]prop-2-enoate (PubChem CID 11311995) has the molecular formula C10H15BrO4 and a molecular weight of 279.13 g/mol. Its IUPAC name is methyl (E)-3-[(4R,5S)-5-(bromomethyl)-2,2-dimethyl-1,3-dioxolan-4-yl]prop-2-enoate.
| Compound Name | methyl (E)-3-[(4R,5S)-5-(bromomethyl)-2,2-dimethyl-1,3-dioxolan-4-yl]prop-2-enoate |
|---|---|
| PubChem CID | 11311995 |
| Molecular Formula | C10H15BrO4 |
| Molecular Weight | 279.13 g/mol |
| Exact Mass | 278.02 |
| IUPAC Name | methyl (E)-3-[(4R,5S)-5-(bromomethyl)-2,2-dimethyl-1,3-dioxolan-4-yl]prop-2-enoate |
| SMILES | COC(=O)/C=C/[C@H]1OC(C)(C)O[C@@H]1CBr |
| InChI | InChI=1S/C10H15BrO4/c1-10(2)14-7(8(6-11)15-10)4-5-9(12)13-3/h4-5,7-8H,6H2,1-3H3/b5-4+/t7-,8-/m1/s1 |
| InChIKey | DKJJSQVPGSDQQI-IVZJMYDKSA-N |
| XLogP | 1.63 |
| TPSA | 44.76 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 3 |
| Heavy Atoms | 15 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 279.13 |
| LogP ≤ 5 | 1.63 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 4 |
| Structural Alerts | {'alert_name': 'alkyl_halide', 'substructure': 'N/A'}, {'alert_name': 'Michael_acceptor_1', 'substructure': 'N/A'} |
|---|