C15H18FNO3 — CID 11312002
ethyl (3S,4R)-4-(4-fluorophenyl)-1-methyl-2-oxopiperidine-3-carboxylate (PubChem CID 11312002) has the molecular formula C15H18FNO3 and a molecular weight of 279.31 g/mol. Its IUPAC name is ethyl (3S,4R)-4-(4-fluorophenyl)-1-methyl-2-oxopiperidine-3-carboxylate.
| Compound Name | ethyl (3S,4R)-4-(4-fluorophenyl)-1-methyl-2-oxopiperidine-3-carboxylate |
|---|---|
| PubChem CID | 11312002 |
| Molecular Formula | C15H18FNO3 |
| Molecular Weight | 279.31 g/mol |
| Exact Mass | 279.13 |
| IUPAC Name | ethyl (3S,4R)-4-(4-fluorophenyl)-1-methyl-2-oxopiperidine-3-carboxylate |
| SMILES | CCOC(=O)[C@@H]1C(=O)N(C)CC[C@H]1c1ccc(F)cc1 |
| InChI | InChI=1S/C15H18FNO3/c1-3-20-15(19)13-12(8-9-17(2)14(13)18)10-4-6-11(16)7-5-10/h4-7,12-13H,3,8-9H2,1-2H3/t12-,13-/m0/s1 |
| InChIKey | LYCKUVQSXKGPSI-STQMWFEESA-N |
| XLogP | 1.95 |
| TPSA | 46.61 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 3 |
| Heavy Atoms | 20 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 279.31 |
| LogP ≤ 5 | 1.95 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 3 |
| Structural Alerts | {'alert_name': 'beta-keto/anhydride', 'substructure': 'N/A'} |
|---|