C18H20FN3O2 — CID 113120177
3-[acetyl(pyridin-2-ylmethyl)amino]-N-[(4-fluorophenyl)methyl]propanamide (PubChem CID 113120177) has the molecular formula C18H20FN3O2 and a molecular weight of 329.38 g/mol. Its IUPAC name is 3-[acetyl(pyridin-2-ylmethyl)amino]-N-[(4-fluorophenyl)methyl]propanamide.
| Compound Name | 3-[acetyl(pyridin-2-ylmethyl)amino]-N-[(4-fluorophenyl)methyl]propanamide |
|---|---|
| PubChem CID | 113120177 |
| Molecular Formula | C18H20FN3O2 |
| Molecular Weight | 329.38 g/mol |
| Exact Mass | 329.15 |
| IUPAC Name | 3-[acetyl(pyridin-2-ylmethyl)amino]-N-[(4-fluorophenyl)methyl]propanamide |
| SMILES | CC(=O)N(CCC(=O)NCc1ccc(F)cc1)Cc1ccccn1 |
| InChI | InChI=1S/C18H20FN3O2/c1-14(23)22(13-17-4-2-3-10-20-17)11-9-18(24)21-12-15-5-7-16(19)8-6-15/h2-8,10H,9,11-13H2,1H3,(H,21,24) |
| InChIKey | MCAXFNFJRJWTRV-UHFFFAOYSA-N |
| XLogP | 2.28 |
| TPSA | 62.30 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 7 |
| Heavy Atoms | 24 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 329.38 |
| LogP ≤ 5 | 2.28 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 3 |