About (1a-phenyl-7,7a-dihydro-1H-cyclopropa[b]chromen-7-yl) acetate
(1a-phenyl-7,7a-dihydro-1H-cyclopropa[b]chromen-7-yl) acetate (PubChem CID 11312023) has the molecular formula C18H16O3
and a molecular weight of 280.32 g/mol. Its IUPAC name is (1a-phenyl-7,7a-dihydro-1H-cyclopropa[b]chromen-7-yl) acetate.
Analyze (1a-phenyl-7,7a-dihydro-1H-cyclopropa[b]chromen-7-yl) acetate with MolForge
Explore ADMET properties, 3D molecular structure, drug-likeness score, and discover similar compounds using our AI-powered platform.
Launch Full Analysis
Frequently Asked Questions
What is the IUPAC name of (1a-phenyl-7,7a-dihydro-1H-cyclopropa[b]chromen-7-yl) acetate?
The IUPAC name of (1a-phenyl-7,7a-dihydro-1H-cyclopropa[b]chromen-7-yl) acetate (CID 11312023) is (1a-phenyl-7,7a-dihydro-1H-cyclopropa[b]chromen-7-yl) acetate.
What is the SMILES notation for (1a-phenyl-7,7a-dihydro-1H-cyclopropa[b]chromen-7-yl) acetate?
The canonical SMILES for (1a-phenyl-7,7a-dihydro-1H-cyclopropa[b]chromen-7-yl) acetate is CC(=O)OC1c2ccccc2OC2(c3ccccc3)CC12.
What is the InChIKey of (1a-phenyl-7,7a-dihydro-1H-cyclopropa[b]chromen-7-yl) acetate?
The InChIKey is MCNCSQPPMOKGND-UHFFFAOYSA-N. The full InChI is InChI=1S/C18H16O3/c1-12(19)20-17-14-9-5-6-10-16(14)21-18(11-15(17)18)13-7-3-2-4-8-13/h2-10,15,17H,11H2,1H3.
What are the key properties of (1a-phenyl-7,7a-dihydro-1H-cyclopropa[b]chromen-7-yl) acetate?
(1a-phenyl-7,7a-dihydro-1H-cyclopropa[b]chromen-7-yl) acetate has a molecular weight of 280.32 g/mol, XLogP of 3.60, 2 rotatable bonds, 0 hydrogen bond donors, and 3 hydrogen bond acceptors.
Where does this data come from?
All data for (1a-phenyl-7,7a-dihydro-1H-cyclopropa[b]chromen-7-yl) acetate is sourced from PubChem (CID 11312023), the world's largest open chemistry database maintained by the National Library of Medicine (NIH).