C22H30N4O2 — CID 113120329
3-[acetyl(pyridin-2-ylmethyl)amino]-N-[4-(diethylamino)-2-methylphenyl]propanamide (PubChem CID 113120329) has the molecular formula C22H30N4O2 and a molecular weight of 382.51 g/mol. Its IUPAC name is 3-[acetyl(pyridin-2-ylmethyl)amino]-N-[4-(diethylamino)-2-methylphenyl]propanamide.
| Compound Name | 3-[acetyl(pyridin-2-ylmethyl)amino]-N-[4-(diethylamino)-2-methylphenyl]propanamide |
|---|---|
| PubChem CID | 113120329 |
| Molecular Formula | C22H30N4O2 |
| Molecular Weight | 382.51 g/mol |
| Exact Mass | 382.24 |
| IUPAC Name | 3-[acetyl(pyridin-2-ylmethyl)amino]-N-[4-(diethylamino)-2-methylphenyl]propanamide |
| SMILES | CCN(CC)c1ccc(NC(=O)CCN(Cc2ccccn2)C(C)=O)c(C)c1 |
| InChI | InChI=1S/C22H30N4O2/c1-5-25(6-2)20-10-11-21(17(3)15-20)24-22(28)12-14-26(18(4)27)16-19-9-7-8-13-23-19/h7-11,13,15H,5-6,12,14,16H2,1-4H3,(H,24,28) |
| InChIKey | YTCSZNBBHCMWHF-UHFFFAOYSA-N |
| XLogP | 3.61 |
| TPSA | 65.54 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 9 |
| Heavy Atoms | 28 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 382.51 |
| LogP ≤ 5 | 3.61 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 4 |
| Structural Alerts | {'alert_name': 'anil_di_alk_A(478)', 'substructure': 'N/A'} |
|---|