About (2R,3R)-2,3-bis(4-chlorophenyl)thiirane
(2R,3R)-2,3-bis(4-chlorophenyl)thiirane (PubChem CID 11312048) has the molecular formula C14H10Cl2S
and a molecular weight of 281.21 g/mol. Its IUPAC name is (2R,3R)-2,3-bis(4-chlorophenyl)thiirane.
Molecular Properties
| Compound Name | (2R,3R)-2,3-bis(4-chlorophenyl)thiirane |
| PubChem CID | 11312048 |
| Molecular Formula | C14H10Cl2S |
| Molecular Weight | 281.21 g/mol |
| Exact Mass | 279.99 |
| IUPAC Name | (2R,3R)-2,3-bis(4-chlorophenyl)thiirane |
| SMILES | Clc1ccc([C@H]2S[C@@H]2c2ccc(Cl)cc2)cc1 |
| InChI | InChI=1S/C14H10Cl2S/c15-11-5-1-9(2-6-11)13-14(17-13)10-3-7-12(16)8-4-10/h1-8,13-14H/t13-,14-/m1/s1 |
| InChIKey | ZZVBOLXEUMLHGG-ZIAGYGMSSA-N |
| XLogP | 5.52 |
| TPSA | 0.00 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 1 |
| Rotatable Bonds | 2 |
| Heavy Atoms | 17 |
| Complexity | — |
Lipinski Rule of Five
1 violation
| Rule | Value |
| MW ≤ 500 | 281.21 |
| LogP ≤ 5 | 5.52 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 1 |
Computed Properties (RDKit)
| Structural Alerts | {'alert_name': 'Three-membered_heterocycle', 'substructure': 'N/A'} |
|---|
Analyze (2R,3R)-2,3-bis(4-chlorophenyl)thiirane with MolForge
Explore ADMET properties, 3D molecular structure, drug-likeness score, and discover similar compounds using our AI-powered platform.
Launch Full Analysis
Frequently Asked Questions
What is the IUPAC name of (2R,3R)-2,3-bis(4-chlorophenyl)thiirane?
The IUPAC name of (2R,3R)-2,3-bis(4-chlorophenyl)thiirane (CID 11312048) is (2R,3R)-2,3-bis(4-chlorophenyl)thiirane.
What is the SMILES notation for (2R,3R)-2,3-bis(4-chlorophenyl)thiirane?
The canonical SMILES for (2R,3R)-2,3-bis(4-chlorophenyl)thiirane is Clc1ccc([C@H]2S[C@@H]2c2ccc(Cl)cc2)cc1.
What is the InChIKey of (2R,3R)-2,3-bis(4-chlorophenyl)thiirane?
The InChIKey is ZZVBOLXEUMLHGG-ZIAGYGMSSA-N. The full InChI is InChI=1S/C14H10Cl2S/c15-11-5-1-9(2-6-11)13-14(17-13)10-3-7-12(16)8-4-10/h1-8,13-14H/t13-,14-/m1/s1.
What are the key properties of (2R,3R)-2,3-bis(4-chlorophenyl)thiirane?
(2R,3R)-2,3-bis(4-chlorophenyl)thiirane has a molecular weight of 281.21 g/mol, XLogP of 5.52, 2 rotatable bonds, 0 hydrogen bond donors, and 1 hydrogen bond acceptors.
Where does this data come from?
All data for (2R,3R)-2,3-bis(4-chlorophenyl)thiirane is sourced from PubChem (CID 11312048), the world's largest open chemistry database maintained by the National Library of Medicine (NIH).