C14H10Cl2S — CID 11312048
(2R,3R)-2,3-bis(4-chlorophenyl)thiirane (PubChem CID 11312048) has the molecular formula C14H10Cl2S and a molecular weight of 281.21 g/mol. Its IUPAC name is (2R,3R)-2,3-bis(4-chlorophenyl)thiirane.
| Compound Name | (2R,3R)-2,3-bis(4-chlorophenyl)thiirane |
|---|---|
| PubChem CID | 11312048 |
| Molecular Formula | C14H10Cl2S |
| Molecular Weight | 281.21 g/mol |
| Exact Mass | 279.99 |
| IUPAC Name | (2R,3R)-2,3-bis(4-chlorophenyl)thiirane |
| SMILES | Clc1ccc([C@H]2S[C@@H]2c2ccc(Cl)cc2)cc1 |
| InChI | InChI=1S/C14H10Cl2S/c15-11-5-1-9(2-6-11)13-14(17-13)10-3-7-12(16)8-4-10/h1-8,13-14H/t13-,14-/m1/s1 |
| InChIKey | ZZVBOLXEUMLHGG-ZIAGYGMSSA-N |
| XLogP | 5.52 |
| TPSA | 0.00 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 1 |
| Rotatable Bonds | 2 |
| Heavy Atoms | 17 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 281.21 |
| LogP ≤ 5 | 5.52 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 1 |
| Structural Alerts | {'alert_name': 'Three-membered_heterocycle', 'substructure': 'N/A'} |
|---|