About 4-sulfanyl-5-(2,4,6-trimethylphenyl)dithiole-3-thione
4-sulfanyl-5-(2,4,6-trimethylphenyl)dithiole-3-thione (PubChem CID 11312157) has the molecular formula C12H12S4
and a molecular weight of 284.50 g/mol. Its IUPAC name is 4-sulfanyl-5-(2,4,6-trimethylphenyl)dithiole-3-thione.
Molecular Properties
| Compound Name | 4-sulfanyl-5-(2,4,6-trimethylphenyl)dithiole-3-thione |
| PubChem CID | 11312157 |
| Molecular Formula | C12H12S4 |
| Molecular Weight | 284.50 g/mol |
| Exact Mass | 283.98 |
| IUPAC Name | 4-sulfanyl-5-(2,4,6-trimethylphenyl)dithiole-3-thione |
| SMILES | Cc1cc(C)c(-c2ssc(=S)c2S)c(C)c1 |
| InChI | InChI=1S/C12H12S4/c1-6-4-7(2)9(8(3)5-6)11-10(13)12(14)16-15-11/h4-5,13H,1-3H3 |
| InChIKey | MGJBSDUOWGFBCN-UHFFFAOYSA-N |
| XLogP | 5.42 |
| TPSA | 0.00 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 1 |
| Heavy Atoms | 16 |
| Complexity | — |
Lipinski Rule of Five
1 violation
| Rule | Value |
| MW ≤ 500 | 284.50 |
| LogP ≤ 5 | 5.42 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 4 |
Computed Properties (RDKit)
| Structural Alerts | {'alert_name': 'Thiocarbonyl_group', 'substructure': 'N/A'}, {'alert_name': 'thiol_2', 'substructure': 'N/A'} |
|---|
Analyze 4-sulfanyl-5-(2,4,6-trimethylphenyl)dithiole-3-thione with MolForge
Explore ADMET properties, 3D molecular structure, drug-likeness score, and discover similar compounds using our AI-powered platform.
Launch Full Analysis
Frequently Asked Questions
What is the IUPAC name of 4-sulfanyl-5-(2,4,6-trimethylphenyl)dithiole-3-thione?
The IUPAC name of 4-sulfanyl-5-(2,4,6-trimethylphenyl)dithiole-3-thione (CID 11312157) is 4-sulfanyl-5-(2,4,6-trimethylphenyl)dithiole-3-thione.
What is the SMILES notation for 4-sulfanyl-5-(2,4,6-trimethylphenyl)dithiole-3-thione?
The canonical SMILES for 4-sulfanyl-5-(2,4,6-trimethylphenyl)dithiole-3-thione is Cc1cc(C)c(-c2ssc(=S)c2S)c(C)c1.
What is the InChIKey of 4-sulfanyl-5-(2,4,6-trimethylphenyl)dithiole-3-thione?
The InChIKey is MGJBSDUOWGFBCN-UHFFFAOYSA-N. The full InChI is InChI=1S/C12H12S4/c1-6-4-7(2)9(8(3)5-6)11-10(13)12(14)16-15-11/h4-5,13H,1-3H3.
What are the key properties of 4-sulfanyl-5-(2,4,6-trimethylphenyl)dithiole-3-thione?
4-sulfanyl-5-(2,4,6-trimethylphenyl)dithiole-3-thione has a molecular weight of 284.50 g/mol, XLogP of 5.42, 1 rotatable bonds, 1 hydrogen bond donors, and 4 hydrogen bond acceptors.
Where does this data come from?
All data for 4-sulfanyl-5-(2,4,6-trimethylphenyl)dithiole-3-thione is sourced from PubChem (CID 11312157), the world's largest open chemistry database maintained by the National Library of Medicine (NIH).