C16H22F2N2O2 — CID 113123156
3-[acetyl(pentyl)amino]-N-(2,4-difluorophenyl)propanamide (PubChem CID 113123156) has the molecular formula C16H22F2N2O2 and a molecular weight of 312.36 g/mol. Its IUPAC name is 3-[acetyl(pentyl)amino]-N-(2,4-difluorophenyl)propanamide.
| Compound Name | 3-[acetyl(pentyl)amino]-N-(2,4-difluorophenyl)propanamide |
|---|---|
| PubChem CID | 113123156 |
| Molecular Formula | C16H22F2N2O2 |
| Molecular Weight | 312.36 g/mol |
| Exact Mass | 312.16 |
| IUPAC Name | 3-[acetyl(pentyl)amino]-N-(2,4-difluorophenyl)propanamide |
| SMILES | CCCCCN(CCC(=O)Nc1ccc(F)cc1F)C(C)=O |
| InChI | InChI=1S/C16H22F2N2O2/c1-3-4-5-9-20(12(2)21)10-8-16(22)19-15-7-6-13(17)11-14(15)18/h6-7,11H,3-5,8-10H2,1-2H3,(H,19,22) |
| InChIKey | SFJDNDZOIPXUAO-UHFFFAOYSA-N |
| XLogP | 3.33 |
| TPSA | 49.41 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 2 |
| Rotatable Bonds | 8 |
| Heavy Atoms | 22 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 312.36 |
| LogP ≤ 5 | 3.33 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 2 |
| Structural Alerts | {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'} |
|---|