C22H28N2O2 — CID 113124213
3-(N-acetyl-2,4-dimethylanilino)-N-(2-ethyl-6-methylphenyl)propanamide (PubChem CID 113124213) has the molecular formula C22H28N2O2 and a molecular weight of 352.48 g/mol. Its IUPAC name is 3-(N-acetyl-2,4-dimethylanilino)-N-(2-ethyl-6-methylphenyl)propanamide.
| Compound Name | 3-(N-acetyl-2,4-dimethylanilino)-N-(2-ethyl-6-methylphenyl)propanamide |
|---|---|
| PubChem CID | 113124213 |
| Molecular Formula | C22H28N2O2 |
| Molecular Weight | 352.48 g/mol |
| Exact Mass | 352.22 |
| IUPAC Name | 3-(N-acetyl-2,4-dimethylanilino)-N-(2-ethyl-6-methylphenyl)propanamide |
| SMILES | CCc1cccc(C)c1NC(=O)CCN(C(C)=O)c1ccc(C)cc1C |
| InChI | InChI=1S/C22H28N2O2/c1-6-19-9-7-8-16(3)22(19)23-21(26)12-13-24(18(5)25)20-11-10-15(2)14-17(20)4/h7-11,14H,6,12-13H2,1-5H3,(H,23,26) |
| InChIKey | XBVZBFULHHWALR-UHFFFAOYSA-N |
| XLogP | 4.56 |
| TPSA | 49.41 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 2 |
| Rotatable Bonds | 6 |
| Heavy Atoms | 26 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 352.48 |
| LogP ≤ 5 | 4.56 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 2 |