About 3-[(E)-5-(benzenesulfonyl)-3-methylpent-3-enyl]-2,2-dimethyloxirane
3-[(E)-5-(benzenesulfonyl)-3-methylpent-3-enyl]-2,2-dimethyloxirane (PubChem CID 11312438) has the molecular formula C16H22O3S
and a molecular weight of 294.42 g/mol. Its IUPAC name is 3-[(E)-5-(benzenesulfonyl)-3-methylpent-3-enyl]-2,2-dimethyloxirane.
Molecular Properties
| Compound Name | 3-[(E)-5-(benzenesulfonyl)-3-methylpent-3-enyl]-2,2-dimethyloxirane |
| PubChem CID | 11312438 |
| Molecular Formula | C16H22O3S |
| Molecular Weight | 294.42 g/mol |
| Exact Mass | 294.13 |
| IUPAC Name | 3-[(E)-5-(benzenesulfonyl)-3-methylpent-3-enyl]-2,2-dimethyloxirane |
| SMILES | C/C(=C\CS(=O)(=O)c1ccccc1)CCC1OC1(C)C |
| InChI | InChI=1S/C16H22O3S/c1-13(9-10-15-16(2,3)19-15)11-12-20(17,18)14-7-5-4-6-8-14/h4-8,11,15H,9-10,12H2,1-3H3/b13-11+ |
| InChIKey | WONFKPYAPGPJLQ-ACCUITESSA-N |
| XLogP | 3.36 |
| TPSA | 46.67 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 6 |
| Heavy Atoms | 20 |
| Complexity | — |
Lipinski Rule of Five
Passes Rule of Five
| Rule | Value |
| MW ≤ 500 | 294.42 |
| LogP ≤ 5 | 3.36 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 3 |
Computed Properties (RDKit)
| Structural Alerts | {'alert_name': 'isolated_alkene', 'substructure': 'N/A'}, {'alert_name': 'Three-membered_heterocycle', 'substructure': 'N/A'} |
|---|
Analyze 3-[(E)-5-(benzenesulfonyl)-3-methylpent-3-enyl]-2,2-dimethyloxirane with MolForge
Explore ADMET properties, 3D molecular structure, drug-likeness score, and discover similar compounds using our AI-powered platform.
Launch Full Analysis
Frequently Asked Questions
What is the IUPAC name of 3-[(E)-5-(benzenesulfonyl)-3-methylpent-3-enyl]-2,2-dimethyloxirane?
The IUPAC name of 3-[(E)-5-(benzenesulfonyl)-3-methylpent-3-enyl]-2,2-dimethyloxirane (CID 11312438) is 3-[(E)-5-(benzenesulfonyl)-3-methylpent-3-enyl]-2,2-dimethyloxirane.
What is the SMILES notation for 3-[(E)-5-(benzenesulfonyl)-3-methylpent-3-enyl]-2,2-dimethyloxirane?
The canonical SMILES for 3-[(E)-5-(benzenesulfonyl)-3-methylpent-3-enyl]-2,2-dimethyloxirane is C/C(=C\CS(=O)(=O)c1ccccc1)CCC1OC1(C)C.
What is the InChIKey of 3-[(E)-5-(benzenesulfonyl)-3-methylpent-3-enyl]-2,2-dimethyloxirane?
The InChIKey is WONFKPYAPGPJLQ-ACCUITESSA-N. The full InChI is InChI=1S/C16H22O3S/c1-13(9-10-15-16(2,3)19-15)11-12-20(17,18)14-7-5-4-6-8-14/h4-8,11,15H,9-10,12H2,1-3H3/b13-11+.
What are the key properties of 3-[(E)-5-(benzenesulfonyl)-3-methylpent-3-enyl]-2,2-dimethyloxirane?
3-[(E)-5-(benzenesulfonyl)-3-methylpent-3-enyl]-2,2-dimethyloxirane has a molecular weight of 294.42 g/mol, XLogP of 3.36, 6 rotatable bonds, 0 hydrogen bond donors, and 3 hydrogen bond acceptors.
Where does this data come from?
All data for 3-[(E)-5-(benzenesulfonyl)-3-methylpent-3-enyl]-2,2-dimethyloxirane is sourced from PubChem (CID 11312438), the world's largest open chemistry database maintained by the National Library of Medicine (NIH).