C20H24N2O2 — CID 113124717
3-(N-acetyl-3,5-dimethylanilino)-N-(2-methylphenyl)propanamide (PubChem CID 113124717) has the molecular formula C20H24N2O2 and a molecular weight of 324.42 g/mol. Its IUPAC name is 3-(N-acetyl-3,5-dimethylanilino)-N-(2-methylphenyl)propanamide.
| Compound Name | 3-(N-acetyl-3,5-dimethylanilino)-N-(2-methylphenyl)propanamide |
|---|---|
| PubChem CID | 113124717 |
| Molecular Formula | C20H24N2O2 |
| Molecular Weight | 324.42 g/mol |
| Exact Mass | 324.18 |
| IUPAC Name | 3-(N-acetyl-3,5-dimethylanilino)-N-(2-methylphenyl)propanamide |
| SMILES | CC(=O)N(CCC(=O)Nc1ccccc1C)c1cc(C)cc(C)c1 |
| InChI | InChI=1S/C20H24N2O2/c1-14-11-15(2)13-18(12-14)22(17(4)23)10-9-20(24)21-19-8-6-5-7-16(19)3/h5-8,11-13H,9-10H2,1-4H3,(H,21,24) |
| InChIKey | PQUHNDYPYJBNJI-UHFFFAOYSA-N |
| XLogP | 3.99 |
| TPSA | 49.41 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 2 |
| Rotatable Bonds | 5 |
| Heavy Atoms | 24 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 324.42 |
| LogP ≤ 5 | 3.99 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 2 |