C20H22Cl2N2O2 — CID 113126107
3-(N-acetyl-2,4,6-trimethylanilino)-N-(3,4-dichlorophenyl)propanamide (PubChem CID 113126107) has the molecular formula C20H22Cl2N2O2 and a molecular weight of 393.31 g/mol. Its IUPAC name is 3-(N-acetyl-2,4,6-trimethylanilino)-N-(3,4-dichlorophenyl)propanamide.
| Compound Name | 3-(N-acetyl-2,4,6-trimethylanilino)-N-(3,4-dichlorophenyl)propanamide |
|---|---|
| PubChem CID | 113126107 |
| Molecular Formula | C20H22Cl2N2O2 |
| Molecular Weight | 393.31 g/mol |
| Exact Mass | 392.11 |
| IUPAC Name | 3-(N-acetyl-2,4,6-trimethylanilino)-N-(3,4-dichlorophenyl)propanamide |
| SMILES | CC(=O)N(CCC(=O)Nc1ccc(Cl)c(Cl)c1)c1c(C)cc(C)cc1C |
| InChI | InChI=1S/C20H22Cl2N2O2/c1-12-9-13(2)20(14(3)10-12)24(15(4)25)8-7-19(26)23-16-5-6-17(21)18(22)11-16/h5-6,9-11H,7-8H2,1-4H3,(H,23,26) |
| InChIKey | PQFGKOIKLXANLY-UHFFFAOYSA-N |
| XLogP | 5.30 |
| TPSA | 49.41 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 2 |
| Rotatable Bonds | 5 |
| Heavy Atoms | 26 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 393.31 |
| LogP ≤ 5 | 5.30 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 2 |