C16H16N2O4 — CID 11312611
(5R,6R,7S,8R)-5-(hydroxymethyl)-2-(2-phenylethynyl)-5,6,7,8-tetrahydroimidazo[1,2-a]pyridine-6,7,8-triol (PubChem CID 11312611) has the molecular formula C16H16N2O4 and a molecular weight of 300.31 g/mol. Its IUPAC name is (5R,6R,7S,8R)-5-(hydroxymethyl)-2-(2-phenylethynyl)-5,6,7,8-tetrahydroimidazo[1,2-a]pyridine-6,7,8-triol.
| Compound Name | (5R,6R,7S,8R)-5-(hydroxymethyl)-2-(2-phenylethynyl)-5,6,7,8-tetrahydroimidazo[1,2-a]pyridine-6,7,8-triol |
|---|---|
| PubChem CID | 11312611 |
| Molecular Formula | C16H16N2O4 |
| Molecular Weight | 300.31 g/mol |
| Exact Mass | 300.11 |
| IUPAC Name | (5R,6R,7S,8R)-5-(hydroxymethyl)-2-(2-phenylethynyl)-5,6,7,8-tetrahydroimidazo[1,2-a]pyridine-6,7,8-triol |
| SMILES | OC[C@@H]1[C@@H](O)[C@H](O)[C@H](O)c2nc(C#Cc3ccccc3)cn21 |
| InChI | InChI=1S/C16H16N2O4/c19-9-12-13(20)14(21)15(22)16-17-11(8-18(12)16)7-6-10-4-2-1-3-5-10/h1-5,8,12-15,19-22H,9H2/t12-,13-,14+,15+/m1/s1 |
| InChIKey | MYCQSFHHCYIHIO-KBXIAJHMSA-N |
| XLogP | -0.41 |
| TPSA | 98.74 Ų |
| H-Bond Donors | 4 |
| H-Bond Acceptors | 6 |
| Rotatable Bonds | 1 |
| Heavy Atoms | 22 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 300.31 |
| LogP ≤ 5 | -0.41 |
| H-Bond Donors ≤ 5 | 4 |
| H-Bond Acceptors ≤ 10 | 6 |
| Structural Alerts | {'alert_name': 'triple_bond', 'substructure': 'N/A'} |
|---|