C23H30N2O2 — CID 113126443
3-(N-acetyl-2-tert-butylanilino)-N-(3,5-dimethylphenyl)propanamide (PubChem CID 113126443) has the molecular formula C23H30N2O2 and a molecular weight of 366.51 g/mol. Its IUPAC name is 3-(N-acetyl-2-tert-butylanilino)-N-(3,5-dimethylphenyl)propanamide.
| Compound Name | 3-(N-acetyl-2-tert-butylanilino)-N-(3,5-dimethylphenyl)propanamide |
|---|---|
| PubChem CID | 113126443 |
| Molecular Formula | C23H30N2O2 |
| Molecular Weight | 366.51 g/mol |
| Exact Mass | 366.23 |
| IUPAC Name | 3-(N-acetyl-2-tert-butylanilino)-N-(3,5-dimethylphenyl)propanamide |
| SMILES | CC(=O)N(CCC(=O)Nc1cc(C)cc(C)c1)c1ccccc1C(C)(C)C |
| InChI | InChI=1S/C23H30N2O2/c1-16-13-17(2)15-19(14-16)24-22(27)11-12-25(18(3)26)21-10-8-7-9-20(21)23(4,5)6/h7-10,13-15H,11-12H2,1-6H3,(H,24,27) |
| InChIKey | YRZMKGHTBAJYIO-UHFFFAOYSA-N |
| XLogP | 4.98 |
| TPSA | 49.41 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 2 |
| Rotatable Bonds | 5 |
| Heavy Atoms | 27 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 366.51 |
| LogP ≤ 5 | 4.98 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 2 |