C21H26ClN3O2 — CID 113127314
3-(N-acetyl-3-chloroanilino)-N-[4-(diethylamino)phenyl]propanamide (PubChem CID 113127314) has the molecular formula C21H26ClN3O2 and a molecular weight of 387.91 g/mol. Its IUPAC name is 3-(N-acetyl-3-chloroanilino)-N-[4-(diethylamino)phenyl]propanamide.
| Compound Name | 3-(N-acetyl-3-chloroanilino)-N-[4-(diethylamino)phenyl]propanamide |
|---|---|
| PubChem CID | 113127314 |
| Molecular Formula | C21H26ClN3O2 |
| Molecular Weight | 387.91 g/mol |
| Exact Mass | 387.17 |
| IUPAC Name | 3-(N-acetyl-3-chloroanilino)-N-[4-(diethylamino)phenyl]propanamide |
| SMILES | CCN(CC)c1ccc(NC(=O)CCN(C(C)=O)c2cccc(Cl)c2)cc1 |
| InChI | InChI=1S/C21H26ClN3O2/c1-4-24(5-2)19-11-9-18(10-12-19)23-21(27)13-14-25(16(3)26)20-8-6-7-17(22)15-20/h6-12,15H,4-5,13-14H2,1-3H3,(H,23,27) |
| InChIKey | MVVYWKZULXOAAU-UHFFFAOYSA-N |
| XLogP | 4.57 |
| TPSA | 52.65 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 8 |
| Heavy Atoms | 27 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 387.91 |
| LogP ≤ 5 | 4.57 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 3 |
| Structural Alerts | {'alert_name': 'anil_di_alk_A(478)', 'substructure': 'N/A'} |
|---|