C19H18ClF3N2O2 — CID 113127626
3-(N-acetyl-3-chloro-2-methylanilino)-N-[2-(trifluoromethyl)phenyl]propanamide (PubChem CID 113127626) has the molecular formula C19H18ClF3N2O2 and a molecular weight of 398.81 g/mol. Its IUPAC name is 3-(N-acetyl-3-chloro-2-methylanilino)-N-[2-(trifluoromethyl)phenyl]propanamide.
| Compound Name | 3-(N-acetyl-3-chloro-2-methylanilino)-N-[2-(trifluoromethyl)phenyl]propanamide |
|---|---|
| PubChem CID | 113127626 |
| Molecular Formula | C19H18ClF3N2O2 |
| Molecular Weight | 398.81 g/mol |
| Exact Mass | 398.10 |
| IUPAC Name | 3-(N-acetyl-3-chloro-2-methylanilino)-N-[2-(trifluoromethyl)phenyl]propanamide |
| SMILES | CC(=O)N(CCC(=O)Nc1ccccc1C(F)(F)F)c1cccc(Cl)c1C |
| InChI | InChI=1S/C19H18ClF3N2O2/c1-12-15(20)7-5-9-17(12)25(13(2)26)11-10-18(27)24-16-8-4-3-6-14(16)19(21,22)23/h3-9H,10-11H2,1-2H3,(H,24,27) |
| InChIKey | HVAMHRVTOBYKLR-UHFFFAOYSA-N |
| XLogP | 5.05 |
| TPSA | 49.41 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 2 |
| Rotatable Bonds | 5 |
| Heavy Atoms | 27 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 398.81 |
| LogP ≤ 5 | 5.05 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 2 |