C21H25N3O5 — CID 113129105
N-[3-[4-(furan-2-carbonyl)piperazin-1-yl]-3-oxopropyl]-N-(4-methoxyphenyl)acetamide (PubChem CID 113129105) has the molecular formula C21H25N3O5 and a molecular weight of 399.45 g/mol. Its IUPAC name is N-[3-[4-(furan-2-carbonyl)piperazin-1-yl]-3-oxopropyl]-N-(4-methoxyphenyl)acetamide.
| Compound Name | N-[3-[4-(furan-2-carbonyl)piperazin-1-yl]-3-oxopropyl]-N-(4-methoxyphenyl)acetamide |
|---|---|
| PubChem CID | 113129105 |
| Molecular Formula | C21H25N3O5 |
| Molecular Weight | 399.45 g/mol |
| Exact Mass | 399.18 |
| IUPAC Name | N-[3-[4-(furan-2-carbonyl)piperazin-1-yl]-3-oxopropyl]-N-(4-methoxyphenyl)acetamide |
| SMILES | COc1ccc(N(CCC(=O)N2CCN(C(=O)c3ccco3)CC2)C(C)=O)cc1 |
| InChI | InChI=1S/C21H25N3O5/c1-16(25)24(17-5-7-18(28-2)8-6-17)10-9-20(26)22-11-13-23(14-12-22)21(27)19-4-3-15-29-19/h3-8,15H,9-14H2,1-2H3 |
| InChIKey | PCFTUBRUWFSAGT-UHFFFAOYSA-N |
| XLogP | 2.02 |
| TPSA | 83.30 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 6 |
| Heavy Atoms | 29 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 399.45 |
| LogP ≤ 5 | 2.02 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 5 |