C18H18FN3O — CID 11312953
(1R,3E,5R)-3-[[1-(4-fluorophenyl)triazol-4-yl]methylidene]-6,6-dimethylbicyclo[3.1.1]heptan-2-one (PubChem CID 11312953) has the molecular formula C18H18FN3O and a molecular weight of 311.36 g/mol. Its IUPAC name is (1R,3E,5R)-3-[[1-(4-fluorophenyl)triazol-4-yl]methylidene]-6,6-dimethylbicyclo[3.1.1]heptan-2-one.
| Compound Name | (1R,3E,5R)-3-[[1-(4-fluorophenyl)triazol-4-yl]methylidene]-6,6-dimethylbicyclo[3.1.1]heptan-2-one |
|---|---|
| PubChem CID | 11312953 |
| Molecular Formula | C18H18FN3O |
| Molecular Weight | 311.36 g/mol |
| Exact Mass | 311.14 |
| IUPAC Name | (1R,3E,5R)-3-[[1-(4-fluorophenyl)triazol-4-yl]methylidene]-6,6-dimethylbicyclo[3.1.1]heptan-2-one |
| SMILES | CC1(C)[C@H]2C/C(=C\c3cn(-c4ccc(F)cc4)nn3)C(=O)[C@@H]1C2 |
| InChI | InChI=1S/C18H18FN3O/c1-18(2)12-7-11(17(23)16(18)9-12)8-14-10-22(21-20-14)15-5-3-13(19)4-6-15/h3-6,8,10,12,16H,7,9H2,1-2H3/b11-8+/t12-,16-/m0/s1 |
| InChIKey | ZSJZQMAQFIXWPI-YBXGNVEJSA-N |
| XLogP | 3.42 |
| TPSA | 47.78 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 2 |
| Heavy Atoms | 23 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 311.36 |
| LogP ≤ 5 | 3.42 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 4 |
| Structural Alerts | {'alert_name': 'Michael_acceptor_1', 'substructure': 'N/A'} |
|---|