C17H26N2O4 — CID 113129540
3-(N-acetyl-2-methoxy-5-methylanilino)-N-(3-methoxypropyl)propanamide (PubChem CID 113129540) has the molecular formula C17H26N2O4 and a molecular weight of 322.41 g/mol. Its IUPAC name is 3-(N-acetyl-2-methoxy-5-methylanilino)-N-(3-methoxypropyl)propanamide.
| Compound Name | 3-(N-acetyl-2-methoxy-5-methylanilino)-N-(3-methoxypropyl)propanamide |
|---|---|
| PubChem CID | 113129540 |
| Molecular Formula | C17H26N2O4 |
| Molecular Weight | 322.41 g/mol |
| Exact Mass | 322.19 |
| IUPAC Name | 3-(N-acetyl-2-methoxy-5-methylanilino)-N-(3-methoxypropyl)propanamide |
| SMILES | COCCCNC(=O)CCN(C(C)=O)c1cc(C)ccc1OC |
| InChI | InChI=1S/C17H26N2O4/c1-13-6-7-16(23-4)15(12-13)19(14(2)20)10-8-17(21)18-9-5-11-22-3/h6-7,12H,5,8-11H2,1-4H3,(H,18,21) |
| InChIKey | DOEDMZDSWJPONI-UHFFFAOYSA-N |
| XLogP | 1.90 |
| TPSA | 67.87 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 9 |
| Heavy Atoms | 23 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 322.41 |
| LogP ≤ 5 | 1.90 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 4 |
| Structural Alerts | {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'} |
|---|