C17H32O3Si — CID 11312996
tert-butyl-dimethyl-[(1R)-1-[(2S,7R)-7-[(2S)-oxiran-2-yl]-2,3,6,7-tetrahydrooxepin-2-yl]propoxy]silane (PubChem CID 11312996) has the molecular formula C17H32O3Si and a molecular weight of 312.53 g/mol. Its IUPAC name is tert-butyl-dimethyl-[(1R)-1-[(2S,7R)-7-[(2S)-oxiran-2-yl]-2,3,6,7-tetrahydrooxepin-2-yl]propoxy]silane.
| Compound Name | tert-butyl-dimethyl-[(1R)-1-[(2S,7R)-7-[(2S)-oxiran-2-yl]-2,3,6,7-tetrahydrooxepin-2-yl]propoxy]silane |
|---|---|
| PubChem CID | 11312996 |
| Molecular Formula | C17H32O3Si |
| Molecular Weight | 312.53 g/mol |
| Exact Mass | 312.21 |
| IUPAC Name | tert-butyl-dimethyl-[(1R)-1-[(2S,7R)-7-[(2S)-oxiran-2-yl]-2,3,6,7-tetrahydrooxepin-2-yl]propoxy]silane |
| SMILES | CC[C@@H](O[Si](C)(C)C(C)(C)C)[C@@H]1CC=CC[C@H]([C@@H]2CO2)O1 |
| InChI | InChI=1S/C17H32O3Si/c1-7-13(20-21(5,6)17(2,3)4)14-10-8-9-11-15(19-14)16-12-18-16/h8-9,13-16H,7,10-12H2,1-6H3/t13-,14+,15-,16+/m1/s1 |
| InChIKey | WCNYRBMTCZMOMB-QXSJWSMHSA-N |
| XLogP | 4.29 |
| TPSA | 30.99 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 5 |
| Heavy Atoms | 21 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 312.53 |
| LogP ≤ 5 | 4.29 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 3 |
| Structural Alerts | {'alert_name': 'heavy_metal', 'substructure': 'N/A'}, {'alert_name': 'isolated_alkene', 'substructure': 'N/A'}, {'alert_name': 'Three-membered_heterocycle', 'substructure': 'N/A'} |
|---|