C15H22O7 — CID 11313037
[(2R,3S,5R,6S)-3-acetyloxy-6-methoxy-4-methylidene-5-prop-2-enoxyoxan-2-yl]methyl acetate (PubChem CID 11313037) has the molecular formula C15H22O7 and a molecular weight of 314.33 g/mol. Its IUPAC name is [(2R,3S,5R,6S)-3-acetyloxy-6-methoxy-4-methylidene-5-prop-2-enoxyoxan-2-yl]methyl acetate.
| Compound Name | [(2R,3S,5R,6S)-3-acetyloxy-6-methoxy-4-methylidene-5-prop-2-enoxyoxan-2-yl]methyl acetate |
|---|---|
| PubChem CID | 11313037 |
| Molecular Formula | C15H22O7 |
| Molecular Weight | 314.33 g/mol |
| Exact Mass | 314.14 |
| IUPAC Name | [(2R,3S,5R,6S)-3-acetyloxy-6-methoxy-4-methylidene-5-prop-2-enoxyoxan-2-yl]methyl acetate |
| SMILES | C=CCO[C@@H]1C(=C)[C@H](OC(C)=O)[C@@H](COC(C)=O)O[C@@H]1OC |
| InChI | InChI=1S/C15H22O7/c1-6-7-19-14-9(2)13(21-11(4)17)12(8-20-10(3)16)22-15(14)18-5/h6,12-15H,1-2,7-8H2,3-5H3/t12-,13+,14-,15+/m1/s1 |
| InChIKey | LYAZAAMNHJGBAQ-BARDWOONSA-N |
| XLogP | 0.98 |
| TPSA | 80.29 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 7 |
| Rotatable Bonds | 7 |
| Heavy Atoms | 22 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 314.33 |
| LogP ≤ 5 | 0.98 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 7 |
| Structural Alerts | {'alert_name': 'isolated_alkene', 'substructure': 'N/A'} |
|---|