C14H20F3N5 — CID 11313073
2-[6-tert-butyl-4-(trifluoromethyl)-5,6,7,8-tetrahydroquinazolin-2-yl]guanidine (PubChem CID 11313073) has the molecular formula C14H20F3N5 and a molecular weight of 315.34 g/mol. Its IUPAC name is 2-[6-tert-butyl-4-(trifluoromethyl)-5,6,7,8-tetrahydroquinazolin-2-yl]guanidine.
| Compound Name | 2-[6-tert-butyl-4-(trifluoromethyl)-5,6,7,8-tetrahydroquinazolin-2-yl]guanidine |
|---|---|
| PubChem CID | 11313073 |
| Molecular Formula | C14H20F3N5 |
| Molecular Weight | 315.34 g/mol |
| Exact Mass | 315.17 |
| IUPAC Name | 2-[6-tert-butyl-4-(trifluoromethyl)-5,6,7,8-tetrahydroquinazolin-2-yl]guanidine |
| SMILES | CC(C)(C)C1CCc2nc(N=C(N)N)nc(C(F)(F)F)c2C1 |
| InChI | InChI=1S/C14H20F3N5/c1-13(2,3)7-4-5-9-8(6-7)10(14(15,16)17)21-12(20-9)22-11(18)19/h7H,4-6H2,1-3H3,(H4,18,19,20,21,22) |
| InChIKey | DJAZRDWUHJGBPP-UHFFFAOYSA-N |
| XLogP | 2.55 |
| TPSA | 90.18 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 1 |
| Heavy Atoms | 22 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 315.34 |
| LogP ≤ 5 | 2.55 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 3 |
| Structural Alerts | {'alert_name': 'imine_1', 'substructure': 'N/A'}, {'alert_name': 'imine_2', 'substructure': 'N/A'} |
|---|