C22H26N2O5 — CID 113130831
3-(N,4-diacetylanilino)-N-[(3,4-dimethoxyphenyl)methyl]propanamide (PubChem CID 113130831) has the molecular formula C22H26N2O5 and a molecular weight of 398.46 g/mol. Its IUPAC name is 3-(N,4-diacetylanilino)-N-[(3,4-dimethoxyphenyl)methyl]propanamide.
| Compound Name | 3-(N,4-diacetylanilino)-N-[(3,4-dimethoxyphenyl)methyl]propanamide |
|---|---|
| PubChem CID | 113130831 |
| Molecular Formula | C22H26N2O5 |
| Molecular Weight | 398.46 g/mol |
| Exact Mass | 398.18 |
| IUPAC Name | 3-(N,4-diacetylanilino)-N-[(3,4-dimethoxyphenyl)methyl]propanamide |
| SMILES | COc1ccc(CNC(=O)CCN(C(C)=O)c2ccc(C(C)=O)cc2)cc1OC |
| InChI | InChI=1S/C22H26N2O5/c1-15(25)18-6-8-19(9-7-18)24(16(2)26)12-11-22(27)23-14-17-5-10-20(28-3)21(13-17)29-4/h5-10,13H,11-12,14H2,1-4H3,(H,23,27) |
| InChIKey | GXEGKPGQHICSSB-UHFFFAOYSA-N |
| XLogP | 2.97 |
| TPSA | 84.94 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 9 |
| Heavy Atoms | 29 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 398.46 |
| LogP ≤ 5 | 2.97 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 5 |