About 2-methoxyethyl (Z)-3-[(2-chloro-1,3-thiazol-5-yl)methylamino]-2-cyanobut-2-enoate
2-methoxyethyl (Z)-3-[(2-chloro-1,3-thiazol-5-yl)methylamino]-2-cyanobut-2-enoate (PubChem CID 11313092) has the molecular formula C12H14ClN3O3S
and a molecular weight of 315.78 g/mol. Its IUPAC name is 2-methoxyethyl (Z)-3-[(2-chloro-1,3-thiazol-5-yl)methylamino]-2-cyanobut-2-enoate.
Molecular Properties
| Compound Name | 2-methoxyethyl (Z)-3-[(2-chloro-1,3-thiazol-5-yl)methylamino]-2-cyanobut-2-enoate |
| PubChem CID | 11313092 |
| Molecular Formula | C12H14ClN3O3S |
| Molecular Weight | 315.78 g/mol |
| Exact Mass | 315.04 |
| IUPAC Name | 2-methoxyethyl (Z)-3-[(2-chloro-1,3-thiazol-5-yl)methylamino]-2-cyanobut-2-enoate |
| SMILES | COCCOC(=O)/C(C#N)=C(/C)NCc1cnc(Cl)s1 |
| InChI | InChI=1S/C12H14ClN3O3S/c1-8(15-6-9-7-16-12(13)20-9)10(5-14)11(17)19-4-3-18-2/h7,15H,3-4,6H2,1-2H3/b10-8- |
| InChIKey | GKVUNCIBIULJMS-NTMALXAHSA-N |
| XLogP | 1.87 |
| TPSA | 84.24 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 7 |
| Rotatable Bonds | 7 |
| Heavy Atoms | 20 |
| Complexity | — |
Lipinski Rule of Five
Passes Rule of Five
| Rule | Value |
| MW ≤ 500 | 315.78 |
| LogP ≤ 5 | 1.87 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 7 |
Computed Properties (RDKit)
| Structural Alerts | {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'}, {'alert_name': 'conjugated_nitrile_group', 'substructure': 'N/A'}, {'alert_name': 'Michael_acceptor_1', 'substructure': 'N/A'} |
|---|
Analyze 2-methoxyethyl (Z)-3-[(2-chloro-1,3-thiazol-5-yl)methylamino]-2-cyanobut-2-enoate with MolForge
Explore ADMET properties, 3D molecular structure, drug-likeness score, and discover similar compounds using our AI-powered platform.
Launch Full Analysis
Frequently Asked Questions
What is the IUPAC name of 2-methoxyethyl (Z)-3-[(2-chloro-1,3-thiazol-5-yl)methylamino]-2-cyanobut-2-enoate?
The IUPAC name of 2-methoxyethyl (Z)-3-[(2-chloro-1,3-thiazol-5-yl)methylamino]-2-cyanobut-2-enoate (CID 11313092) is 2-methoxyethyl (Z)-3-[(2-chloro-1,3-thiazol-5-yl)methylamino]-2-cyanobut-2-enoate.
What is the SMILES notation for 2-methoxyethyl (Z)-3-[(2-chloro-1,3-thiazol-5-yl)methylamino]-2-cyanobut-2-enoate?
The canonical SMILES for 2-methoxyethyl (Z)-3-[(2-chloro-1,3-thiazol-5-yl)methylamino]-2-cyanobut-2-enoate is COCCOC(=O)/C(C#N)=C(/C)NCc1cnc(Cl)s1.
What is the InChIKey of 2-methoxyethyl (Z)-3-[(2-chloro-1,3-thiazol-5-yl)methylamino]-2-cyanobut-2-enoate?
The InChIKey is GKVUNCIBIULJMS-NTMALXAHSA-N. The full InChI is InChI=1S/C12H14ClN3O3S/c1-8(15-6-9-7-16-12(13)20-9)10(5-14)11(17)19-4-3-18-2/h7,15H,3-4,6H2,1-2H3/b10-8-.
What are the key properties of 2-methoxyethyl (Z)-3-[(2-chloro-1,3-thiazol-5-yl)methylamino]-2-cyanobut-2-enoate?
2-methoxyethyl (Z)-3-[(2-chloro-1,3-thiazol-5-yl)methylamino]-2-cyanobut-2-enoate has a molecular weight of 315.78 g/mol, XLogP of 1.87, 7 rotatable bonds, 1 hydrogen bond donors, and 7 hydrogen bond acceptors.
Where does this data come from?
All data for 2-methoxyethyl (Z)-3-[(2-chloro-1,3-thiazol-5-yl)methylamino]-2-cyanobut-2-enoate is sourced from PubChem (CID 11313092), the world's largest open chemistry database maintained by the National Library of Medicine (NIH).