C11H12F5NS2 — CID 11313144
2,3,4,5,6-pentafluorobenzenecarbodithioate;tetramethylazanium (PubChem CID 11313144) has the molecular formula C11H12F5NS2 and a molecular weight of 317.35 g/mol. Its IUPAC name is 2,3,4,5,6-pentafluorobenzenecarbodithioate;tetramethylazanium.
| Compound Name | 2,3,4,5,6-pentafluorobenzenecarbodithioate;tetramethylazanium |
|---|---|
| PubChem CID | 11313144 |
| Molecular Formula | C11H12F5NS2 |
| Molecular Weight | 317.35 g/mol |
| Exact Mass | 317.03 |
| IUPAC Name | 2,3,4,5,6-pentafluorobenzenecarbodithioate;tetramethylazanium |
| SMILES | C[N+](C)(C)C.Fc1c(F)c(F)c(C(=S)[S-])c(F)c1F |
| InChI | InChI=1S/C7HF5S2.C4H12N/c8-2-1(7(13)14)3(9)5(11)6(12)4(2)10;1-5(2,3)4/h(H,13,14);1-4H3/q;+1/p-1 |
| InChIKey | OAHZGNPZNWLVBO-UHFFFAOYSA-M |
| XLogP | 2.93 |
| TPSA | 0.00 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 2 |
| Rotatable Bonds | 1 |
| Heavy Atoms | 19 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 317.35 |
| LogP ≤ 5 | 2.93 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 2 |
| Structural Alerts | {'alert_name': 'halogenated_ring_1', 'substructure': 'N/A'}, {'alert_name': 'halogenated_ring_2', 'substructure': 'N/A'}, {'alert_name': 'quaternary_nitrogen_2', 'substructure': 'N/A'}, {'alert_name': 'Thiocarbonyl_group', 'substructure': 'N/A'}, {'alert_name': 'thiol_1', 'substructure': 'N/A'} |
|---|