About 4-methyl-3-phenyl-2-(trifluoromethyl)-1,5-benzothiazepine
4-methyl-3-phenyl-2-(trifluoromethyl)-1,5-benzothiazepine (PubChem CID 11313204) has the molecular formula C17H12F3NS
and a molecular weight of 319.35 g/mol. Its IUPAC name is 4-methyl-3-phenyl-2-(trifluoromethyl)-1,5-benzothiazepine.
Molecular Properties
| Compound Name | 4-methyl-3-phenyl-2-(trifluoromethyl)-1,5-benzothiazepine |
| PubChem CID | 11313204 |
| Molecular Formula | C17H12F3NS |
| Molecular Weight | 319.35 g/mol |
| Exact Mass | 319.06 |
| IUPAC Name | 4-methyl-3-phenyl-2-(trifluoromethyl)-1,5-benzothiazepine |
| SMILES | CC1=Nc2ccccc2SC(C(F)(F)F)=C1c1ccccc1 |
| InChI | InChI=1S/C17H12F3NS/c1-11-15(12-7-3-2-4-8-12)16(17(18,19)20)22-14-10-6-5-9-13(14)21-11/h2-10H,1H3 |
| InChIKey | IKGQIXBJXBLFQL-UHFFFAOYSA-N |
| XLogP | 5.86 |
| TPSA | 12.36 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 2 |
| Rotatable Bonds | 1 |
| Heavy Atoms | 22 |
| Complexity | — |
Lipinski Rule of Five
1 violation
| Rule | Value |
| MW ≤ 500 | 319.35 |
| LogP ≤ 5 | 5.86 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 2 |
Analyze 4-methyl-3-phenyl-2-(trifluoromethyl)-1,5-benzothiazepine with MolForge
Explore ADMET properties, 3D molecular structure, drug-likeness score, and discover similar compounds using our AI-powered platform.
Launch Full Analysis
Frequently Asked Questions
What is the IUPAC name of 4-methyl-3-phenyl-2-(trifluoromethyl)-1,5-benzothiazepine?
The IUPAC name of 4-methyl-3-phenyl-2-(trifluoromethyl)-1,5-benzothiazepine (CID 11313204) is 4-methyl-3-phenyl-2-(trifluoromethyl)-1,5-benzothiazepine.
What is the SMILES notation for 4-methyl-3-phenyl-2-(trifluoromethyl)-1,5-benzothiazepine?
The canonical SMILES for 4-methyl-3-phenyl-2-(trifluoromethyl)-1,5-benzothiazepine is CC1=Nc2ccccc2SC(C(F)(F)F)=C1c1ccccc1.
What is the InChIKey of 4-methyl-3-phenyl-2-(trifluoromethyl)-1,5-benzothiazepine?
The InChIKey is IKGQIXBJXBLFQL-UHFFFAOYSA-N. The full InChI is InChI=1S/C17H12F3NS/c1-11-15(12-7-3-2-4-8-12)16(17(18,19)20)22-14-10-6-5-9-13(14)21-11/h2-10H,1H3.
What are the key properties of 4-methyl-3-phenyl-2-(trifluoromethyl)-1,5-benzothiazepine?
4-methyl-3-phenyl-2-(trifluoromethyl)-1,5-benzothiazepine has a molecular weight of 319.35 g/mol, XLogP of 5.86, 1 rotatable bonds, 0 hydrogen bond donors, and 2 hydrogen bond acceptors.
Where does this data come from?
All data for 4-methyl-3-phenyl-2-(trifluoromethyl)-1,5-benzothiazepine is sourced from PubChem (CID 11313204), the world's largest open chemistry database maintained by the National Library of Medicine (NIH).