C20H36N2O — CID 11313239
4-hexyl-3,4,5,6,7,8,9,10,11,12,13,14-dodecahydro-1H-cyclododeca[d]pyrimidin-2-one (PubChem CID 11313239) has the molecular formula C20H36N2O and a molecular weight of 320.52 g/mol. Its IUPAC name is 4-hexyl-3,4,5,6,7,8,9,10,11,12,13,14-dodecahydro-1H-cyclododeca[d]pyrimidin-2-one.
| Compound Name | 4-hexyl-3,4,5,6,7,8,9,10,11,12,13,14-dodecahydro-1H-cyclododeca[d]pyrimidin-2-one |
|---|---|
| PubChem CID | 11313239 |
| Molecular Formula | C20H36N2O |
| Molecular Weight | 320.52 g/mol |
| Exact Mass | 320.28 |
| IUPAC Name | 4-hexyl-3,4,5,6,7,8,9,10,11,12,13,14-dodecahydro-1H-cyclododeca[d]pyrimidin-2-one |
| SMILES | CCCCCCC1NC(=O)NC2=C1CCCCCCCCCC2 |
| InChI | InChI=1S/C20H36N2O/c1-2-3-4-12-15-18-17-14-11-9-7-5-6-8-10-13-16-19(17)22-20(23)21-18/h18H,2-16H2,1H3,(H2,21,22,23) |
| InChIKey | ADMUBSKKHFFXKP-UHFFFAOYSA-N |
| XLogP | 5.81 |
| TPSA | 41.13 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 1 |
| Rotatable Bonds | 5 |
| Heavy Atoms | 23 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 320.52 |
| LogP ≤ 5 | 5.81 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 1 |
| Structural Alerts | {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'} |
|---|