C22H26N2O4 — CID 113133356
ethyl 4-[acetyl-[3-(2,6-dimethylanilino)-3-oxopropyl]amino]benzoate (PubChem CID 113133356) has the molecular formula C22H26N2O4 and a molecular weight of 382.46 g/mol. Its IUPAC name is ethyl 4-[acetyl-[3-(2,6-dimethylanilino)-3-oxopropyl]amino]benzoate.
| Compound Name | ethyl 4-[acetyl-[3-(2,6-dimethylanilino)-3-oxopropyl]amino]benzoate |
|---|---|
| PubChem CID | 113133356 |
| Molecular Formula | C22H26N2O4 |
| Molecular Weight | 382.46 g/mol |
| Exact Mass | 382.19 |
| IUPAC Name | ethyl 4-[acetyl-[3-(2,6-dimethylanilino)-3-oxopropyl]amino]benzoate |
| SMILES | CCOC(=O)c1ccc(N(CCC(=O)Nc2c(C)cccc2C)C(C)=O)cc1 |
| InChI | InChI=1S/C22H26N2O4/c1-5-28-22(27)18-9-11-19(12-10-18)24(17(4)25)14-13-20(26)23-21-15(2)7-6-8-16(21)3/h6-12H,5,13-14H2,1-4H3,(H,23,26) |
| InChIKey | KKNWOZDFGDNSQH-UHFFFAOYSA-N |
| XLogP | 3.86 |
| TPSA | 75.71 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 7 |
| Heavy Atoms | 28 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 382.46 |
| LogP ≤ 5 | 3.86 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 4 |