C19H20Cl2N2O3 — CID 113133925
3-(N-acetyl-2,4-dichloroanilino)-N-(2-methoxy-5-methylphenyl)propanamide (PubChem CID 113133925) has the molecular formula C19H20Cl2N2O3 and a molecular weight of 395.29 g/mol. Its IUPAC name is 3-(N-acetyl-2,4-dichloroanilino)-N-(2-methoxy-5-methylphenyl)propanamide.
| Compound Name | 3-(N-acetyl-2,4-dichloroanilino)-N-(2-methoxy-5-methylphenyl)propanamide |
|---|---|
| PubChem CID | 113133925 |
| Molecular Formula | C19H20Cl2N2O3 |
| Molecular Weight | 395.29 g/mol |
| Exact Mass | 394.09 |
| IUPAC Name | 3-(N-acetyl-2,4-dichloroanilino)-N-(2-methoxy-5-methylphenyl)propanamide |
| SMILES | COc1ccc(C)cc1NC(=O)CCN(C(C)=O)c1ccc(Cl)cc1Cl |
| InChI | InChI=1S/C19H20Cl2N2O3/c1-12-4-7-18(26-3)16(10-12)22-19(25)8-9-23(13(2)24)17-6-5-14(20)11-15(17)21/h4-7,10-11H,8-9H2,1-3H3,(H,22,25) |
| InChIKey | DUENNWJBLYEFFT-UHFFFAOYSA-N |
| XLogP | 4.69 |
| TPSA | 58.64 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 6 |
| Heavy Atoms | 26 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 395.29 |
| LogP ≤ 5 | 4.69 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 3 |