About 1-(5-chloro-2,3-dihydro-1H-inden-1-yl)-3-(1H-indazol-4-yl)urea
1-(5-chloro-2,3-dihydro-1H-inden-1-yl)-3-(1H-indazol-4-yl)urea (PubChem CID 11313411) has the molecular formula C17H15ClN4O
and a molecular weight of 326.79 g/mol. Its IUPAC name is 1-(5-chloro-2,3-dihydro-1H-inden-1-yl)-3-(1H-indazol-4-yl)urea.
Molecular Properties
| Compound Name | 1-(5-chloro-2,3-dihydro-1H-inden-1-yl)-3-(1H-indazol-4-yl)urea |
| PubChem CID | 11313411 |
| Molecular Formula | C17H15ClN4O |
| Molecular Weight | 326.79 g/mol |
| Exact Mass | 326.09 |
| IUPAC Name | 1-(5-chloro-2,3-dihydro-1H-inden-1-yl)-3-(1H-indazol-4-yl)urea |
| SMILES | O=C(Nc1cccc2[nH]ncc12)NC1CCc2cc(Cl)ccc21 |
| InChI | InChI=1S/C17H15ClN4O/c18-11-5-6-12-10(8-11)4-7-15(12)21-17(23)20-14-2-1-3-16-13(14)9-19-22-16/h1-3,5-6,8-9,15H,4,7H2,(H,19,22)(H2,20,21,23) |
| InChIKey | SBVPKBZNKRFVGA-UHFFFAOYSA-N |
| XLogP | 4.03 |
| TPSA | 69.81 Ų |
| H-Bond Donors | 3 |
| H-Bond Acceptors | 2 |
| Rotatable Bonds | 2 |
| Heavy Atoms | 23 |
| Complexity | — |
Lipinski Rule of Five
Passes Rule of Five
| Rule | Value |
| MW ≤ 500 | 326.79 |
| LogP ≤ 5 | 4.03 |
| H-Bond Donors ≤ 5 | 3 |
| H-Bond Acceptors ≤ 10 | 2 |
Analyze 1-(5-chloro-2,3-dihydro-1H-inden-1-yl)-3-(1H-indazol-4-yl)urea with MolForge
Explore ADMET properties, 3D molecular structure, drug-likeness score, and discover similar compounds using our AI-powered platform.
Launch Full Analysis
Frequently Asked Questions
What is the IUPAC name of 1-(5-chloro-2,3-dihydro-1H-inden-1-yl)-3-(1H-indazol-4-yl)urea?
The IUPAC name of 1-(5-chloro-2,3-dihydro-1H-inden-1-yl)-3-(1H-indazol-4-yl)urea (CID 11313411) is 1-(5-chloro-2,3-dihydro-1H-inden-1-yl)-3-(1H-indazol-4-yl)urea.
What is the SMILES notation for 1-(5-chloro-2,3-dihydro-1H-inden-1-yl)-3-(1H-indazol-4-yl)urea?
The canonical SMILES for 1-(5-chloro-2,3-dihydro-1H-inden-1-yl)-3-(1H-indazol-4-yl)urea is O=C(Nc1cccc2[nH]ncc12)NC1CCc2cc(Cl)ccc21.
What is the InChIKey of 1-(5-chloro-2,3-dihydro-1H-inden-1-yl)-3-(1H-indazol-4-yl)urea?
The InChIKey is SBVPKBZNKRFVGA-UHFFFAOYSA-N. The full InChI is InChI=1S/C17H15ClN4O/c18-11-5-6-12-10(8-11)4-7-15(12)21-17(23)20-14-2-1-3-16-13(14)9-19-22-16/h1-3,5-6,8-9,15H,4,7H2,(H,19,22)(H2,20,21,23).
What are the key properties of 1-(5-chloro-2,3-dihydro-1H-inden-1-yl)-3-(1H-indazol-4-yl)urea?
1-(5-chloro-2,3-dihydro-1H-inden-1-yl)-3-(1H-indazol-4-yl)urea has a molecular weight of 326.79 g/mol, XLogP of 4.03, 2 rotatable bonds, 3 hydrogen bond donors, and 2 hydrogen bond acceptors.
Where does this data come from?
All data for 1-(5-chloro-2,3-dihydro-1H-inden-1-yl)-3-(1H-indazol-4-yl)urea is sourced from PubChem (CID 11313411), the world's largest open chemistry database maintained by the National Library of Medicine (NIH).