C23H28N2O4 — CID 113134647
ethyl 2-[acetyl-[3-(N-ethyl-3-methylanilino)-3-oxopropyl]amino]benzoate (PubChem CID 113134647) has the molecular formula C23H28N2O4 and a molecular weight of 396.49 g/mol. Its IUPAC name is ethyl 2-[acetyl-[3-(N-ethyl-3-methylanilino)-3-oxopropyl]amino]benzoate.
| Compound Name | ethyl 2-[acetyl-[3-(N-ethyl-3-methylanilino)-3-oxopropyl]amino]benzoate |
|---|---|
| PubChem CID | 113134647 |
| Molecular Formula | C23H28N2O4 |
| Molecular Weight | 396.49 g/mol |
| Exact Mass | 396.20 |
| IUPAC Name | ethyl 2-[acetyl-[3-(N-ethyl-3-methylanilino)-3-oxopropyl]amino]benzoate |
| SMILES | CCOC(=O)c1ccccc1N(CCC(=O)N(CC)c1cccc(C)c1)C(C)=O |
| InChI | InChI=1S/C23H28N2O4/c1-5-24(19-11-9-10-17(3)16-19)22(27)14-15-25(18(4)26)21-13-8-7-12-20(21)23(28)29-6-2/h7-13,16H,5-6,14-15H2,1-4H3 |
| InChIKey | RIPAQJPVVPMYOO-UHFFFAOYSA-N |
| XLogP | 3.97 |
| TPSA | 66.92 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 8 |
| Heavy Atoms | 29 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 396.49 |
| LogP ≤ 5 | 3.97 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 4 |