C17H21N3O2S — CID 11313543
4-(3,3-dimethylbutanoylamino)-3-methyl-N-(1,3-thiazol-2-yl)benzamide (PubChem CID 11313543) has the molecular formula C17H21N3O2S and a molecular weight of 331.44 g/mol. Its IUPAC name is 4-(3,3-dimethylbutanoylamino)-3-methyl-N-(1,3-thiazol-2-yl)benzamide.
| Compound Name | 4-(3,3-dimethylbutanoylamino)-3-methyl-N-(1,3-thiazol-2-yl)benzamide |
|---|---|
| PubChem CID | 11313543 |
| Molecular Formula | C17H21N3O2S |
| Molecular Weight | 331.44 g/mol |
| Exact Mass | 331.14 |
| IUPAC Name | 4-(3,3-dimethylbutanoylamino)-3-methyl-N-(1,3-thiazol-2-yl)benzamide |
| SMILES | Cc1cc(C(=O)Nc2nccs2)ccc1NC(=O)CC(C)(C)C |
| InChI | InChI=1S/C17H21N3O2S/c1-11-9-12(15(22)20-16-18-7-8-23-16)5-6-13(11)19-14(21)10-17(2,3)4/h5-9H,10H2,1-4H3,(H,19,21)(H,18,20,22) |
| InChIKey | NLVRAFZOIMAUKQ-UHFFFAOYSA-N |
| XLogP | 4.08 |
| TPSA | 71.09 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 4 |
| Heavy Atoms | 23 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 331.44 |
| LogP ≤ 5 | 4.08 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 4 |