C12H26N2O3S — CID 113137004
3-[butan-2-yl(methylsulfonyl)amino]-N-(2-methylpropyl)propanamide (PubChem CID 113137004) has the molecular formula C12H26N2O3S and a molecular weight of 278.42 g/mol. Its IUPAC name is 3-[butan-2-yl(methylsulfonyl)amino]-N-(2-methylpropyl)propanamide.
| Compound Name | 3-[butan-2-yl(methylsulfonyl)amino]-N-(2-methylpropyl)propanamide |
|---|---|
| PubChem CID | 113137004 |
| Molecular Formula | C12H26N2O3S |
| Molecular Weight | 278.42 g/mol |
| Exact Mass | 278.17 |
| IUPAC Name | 3-[butan-2-yl(methylsulfonyl)amino]-N-(2-methylpropyl)propanamide |
| SMILES | CCC(C)N(CCC(=O)NCC(C)C)S(C)(=O)=O |
| InChI | InChI=1S/C12H26N2O3S/c1-6-11(4)14(18(5,16)17)8-7-12(15)13-9-10(2)3/h10-11H,6-9H2,1-5H3,(H,13,15) |
| InChIKey | IIAJKRDREXKAKV-UHFFFAOYSA-N |
| XLogP | 1.21 |
| TPSA | 66.48 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 8 |
| Heavy Atoms | 18 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 278.42 |
| LogP ≤ 5 | 1.21 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 3 |