C16H29N3O5S — CID 113137250
ethyl 4-[3-[cyclopentyl(methylsulfonyl)amino]propanoyl]piperazine-1-carboxylate (PubChem CID 113137250) has the molecular formula C16H29N3O5S and a molecular weight of 375.49 g/mol. Its IUPAC name is ethyl 4-[3-[cyclopentyl(methylsulfonyl)amino]propanoyl]piperazine-1-carboxylate.
| Compound Name | ethyl 4-[3-[cyclopentyl(methylsulfonyl)amino]propanoyl]piperazine-1-carboxylate |
|---|---|
| PubChem CID | 113137250 |
| Molecular Formula | C16H29N3O5S |
| Molecular Weight | 375.49 g/mol |
| Exact Mass | 375.18 |
| IUPAC Name | ethyl 4-[3-[cyclopentyl(methylsulfonyl)amino]propanoyl]piperazine-1-carboxylate |
| SMILES | CCOC(=O)N1CCN(C(=O)CCN(C2CCCC2)S(C)(=O)=O)CC1 |
| InChI | InChI=1S/C16H29N3O5S/c1-3-24-16(21)18-12-10-17(11-13-18)15(20)8-9-19(25(2,22)23)14-6-4-5-7-14/h14H,3-13H2,1-2H3 |
| InChIKey | MPUVQNNYDPXSFT-UHFFFAOYSA-N |
| XLogP | 0.88 |
| TPSA | 87.23 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 6 |
| Heavy Atoms | 25 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 375.49 |
| LogP ≤ 5 | 0.88 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 5 |