C17H31N3O5S — CID 113137420
ethyl 4-[3-[cyclohexyl(methylsulfonyl)amino]propanoyl]piperazine-1-carboxylate (PubChem CID 113137420) has the molecular formula C17H31N3O5S and a molecular weight of 389.52 g/mol. Its IUPAC name is ethyl 4-[3-[cyclohexyl(methylsulfonyl)amino]propanoyl]piperazine-1-carboxylate.
| Compound Name | ethyl 4-[3-[cyclohexyl(methylsulfonyl)amino]propanoyl]piperazine-1-carboxylate |
|---|---|
| PubChem CID | 113137420 |
| Molecular Formula | C17H31N3O5S |
| Molecular Weight | 389.52 g/mol |
| Exact Mass | 389.20 |
| IUPAC Name | ethyl 4-[3-[cyclohexyl(methylsulfonyl)amino]propanoyl]piperazine-1-carboxylate |
| SMILES | CCOC(=O)N1CCN(C(=O)CCN(C2CCCCC2)S(C)(=O)=O)CC1 |
| InChI | InChI=1S/C17H31N3O5S/c1-3-25-17(22)19-13-11-18(12-14-19)16(21)9-10-20(26(2,23)24)15-7-5-4-6-8-15/h15H,3-14H2,1-2H3 |
| InChIKey | RYJXLVNIJCNFPA-UHFFFAOYSA-N |
| XLogP | 1.27 |
| TPSA | 87.23 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 6 |
| Heavy Atoms | 26 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 389.52 |
| LogP ≤ 5 | 1.27 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 5 |