C13H18ClFN2O4S — CID 113137731
N-(3-chloro-4-fluorophenyl)-3-[2-methoxyethyl(methylsulfonyl)amino]propanamide (PubChem CID 113137731) has the molecular formula C13H18ClFN2O4S and a molecular weight of 352.82 g/mol. Its IUPAC name is N-(3-chloro-4-fluorophenyl)-3-[2-methoxyethyl(methylsulfonyl)amino]propanamide.
| Compound Name | N-(3-chloro-4-fluorophenyl)-3-[2-methoxyethyl(methylsulfonyl)amino]propanamide |
|---|---|
| PubChem CID | 113137731 |
| Molecular Formula | C13H18ClFN2O4S |
| Molecular Weight | 352.82 g/mol |
| Exact Mass | 352.07 |
| IUPAC Name | N-(3-chloro-4-fluorophenyl)-3-[2-methoxyethyl(methylsulfonyl)amino]propanamide |
| SMILES | COCCN(CCC(=O)Nc1ccc(F)c(Cl)c1)S(C)(=O)=O |
| InChI | InChI=1S/C13H18ClFN2O4S/c1-21-8-7-17(22(2,19)20)6-5-13(18)16-10-3-4-12(15)11(14)9-10/h3-4,9H,5-8H2,1-2H3,(H,16,18) |
| InChIKey | GWAXNRTXFOKNFP-UHFFFAOYSA-N |
| XLogP | 1.72 |
| TPSA | 75.71 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 8 |
| Heavy Atoms | 22 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 352.82 |
| LogP ≤ 5 | 1.72 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 4 |