C13H26N2O4S — CID 113137927
N-butan-2-yl-3-[methylsulfonyl(oxolan-2-ylmethyl)amino]propanamide (PubChem CID 113137927) has the molecular formula C13H26N2O4S and a molecular weight of 306.43 g/mol. Its IUPAC name is N-butan-2-yl-3-[methylsulfonyl(oxolan-2-ylmethyl)amino]propanamide.
| Compound Name | N-butan-2-yl-3-[methylsulfonyl(oxolan-2-ylmethyl)amino]propanamide |
|---|---|
| PubChem CID | 113137927 |
| Molecular Formula | C13H26N2O4S |
| Molecular Weight | 306.43 g/mol |
| Exact Mass | 306.16 |
| IUPAC Name | N-butan-2-yl-3-[methylsulfonyl(oxolan-2-ylmethyl)amino]propanamide |
| SMILES | CCC(C)NC(=O)CCN(CC1CCCO1)S(C)(=O)=O |
| InChI | InChI=1S/C13H26N2O4S/c1-4-11(2)14-13(16)7-8-15(20(3,17)18)10-12-6-5-9-19-12/h11-12H,4-10H2,1-3H3,(H,14,16) |
| InChIKey | RCTRNFKNNUFMKG-UHFFFAOYSA-N |
| XLogP | 0.73 |
| TPSA | 75.71 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 8 |
| Heavy Atoms | 20 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 306.43 |
| LogP ≤ 5 | 0.73 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 4 |