C16H21BrO3 — CID 11313844
(3S)-7-bromo-4,4-dimethyl-3-(2-methylbut-3-en-2-yloxy)-2,3-dihydro-1,5-benzodioxepine (PubChem CID 11313844) has the molecular formula C16H21BrO3 and a molecular weight of 341.25 g/mol. Its IUPAC name is (3S)-7-bromo-4,4-dimethyl-3-(2-methylbut-3-en-2-yloxy)-2,3-dihydro-1,5-benzodioxepine.
| Compound Name | (3S)-7-bromo-4,4-dimethyl-3-(2-methylbut-3-en-2-yloxy)-2,3-dihydro-1,5-benzodioxepine |
|---|---|
| PubChem CID | 11313844 |
| Molecular Formula | C16H21BrO3 |
| Molecular Weight | 341.25 g/mol |
| Exact Mass | 340.07 |
| IUPAC Name | (3S)-7-bromo-4,4-dimethyl-3-(2-methylbut-3-en-2-yloxy)-2,3-dihydro-1,5-benzodioxepine |
| SMILES | C=CC(C)(C)O[C@H]1COc2ccc(Br)cc2OC1(C)C |
| InChI | InChI=1S/C16H21BrO3/c1-6-15(2,3)20-14-10-18-12-8-7-11(17)9-13(12)19-16(14,4)5/h6-9,14H,1,10H2,2-5H3/t14-/m0/s1 |
| InChIKey | IMIHGYSUNUEQKV-AWEZNQCLSA-N |
| XLogP | 4.35 |
| TPSA | 27.69 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 3 |
| Heavy Atoms | 20 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 341.25 |
| LogP ≤ 5 | 4.35 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 3 |
| Structural Alerts | {'alert_name': 'isolated_alkene', 'substructure': 'N/A'} |
|---|